C24H30ClN5 — CID 20963288
2-(4-chlorophenyl)-N-[3-(4-propylpiperazin-1-yl)propyl]quinazolin-4-amine (PubChem CID 20963288) has the molecular formula C24H30ClN5 and a molecular weight of 423.99 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[3-(4-propylpiperazin-1-yl)propyl]quinazolin-4-amine.
| Compound Name | 2-(4-chlorophenyl)-N-[3-(4-propylpiperazin-1-yl)propyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 20963288 |
| Molecular Formula | C24H30ClN5 |
| Molecular Weight | 423.99 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[3-(4-propylpiperazin-1-yl)propyl]quinazolin-4-amine |
| SMILES | CCCN1CCN(CCCNc2nc(-c3ccc(Cl)cc3)nc3ccccc23)CC1 |
| InChI | InChI=1S/C24H30ClN5/c1-2-13-29-15-17-30(18-16-29)14-5-12-26-24-21-6-3-4-7-22(21)27-23(28-24)19-8-10-20(25)11-9-19/h3-4,6-11H,2,5,12-18H2,1H3,(H,26,27,28) |
| InChIKey | LMJBKTQETHFGKU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.99 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|