C17H20F3N3O2 — CID 21003381
N-cyclohexyl-6,7-dimethoxy-2-(trifluoromethyl)quinazolin-4-amine (PubChem CID 21003381) has the molecular formula C17H20F3N3O2 and a molecular weight of 355.36 g/mol. Its IUPAC name is N-cyclohexyl-6,7-dimethoxy-2-(trifluoromethyl)quinazolin-4-amine.
| Compound Name | N-cyclohexyl-6,7-dimethoxy-2-(trifluoromethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 21003381 |
| Molecular Formula | C17H20F3N3O2 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | N-cyclohexyl-6,7-dimethoxy-2-(trifluoromethyl)quinazolin-4-amine |
| SMILES | COc1cc2nc(C(F)(F)F)nc(NC3CCCCC3)c2cc1OC |
| InChI | InChI=1S/C17H20F3N3O2/c1-24-13-8-11-12(9-14(13)25-2)22-16(17(18,19)20)23-15(11)21-10-6-4-3-5-7-10/h8-10H,3-7H2,1-2H3,(H,21,22,23) |
| InChIKey | XNECJSCBYLNSEU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |