C16H22N4O2 — CID 57342963
4-N-cyclohexyl-6,7-dimethoxyquinazoline-2,4-diamine (PubChem CID 57342963) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 4-N-cyclohexyl-6,7-dimethoxyquinazoline-2,4-diamine.
| Compound Name | 4-N-cyclohexyl-6,7-dimethoxyquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 57342963 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 4-N-cyclohexyl-6,7-dimethoxyquinazoline-2,4-diamine |
| SMILES | COc1cc2nc(N)nc(NC3CCCCC3)c2cc1OC |
| InChI | InChI=1S/C16H22N4O2/c1-21-13-8-11-12(9-14(13)22-2)19-16(17)20-15(11)18-10-6-4-3-5-7-10/h8-10H,3-7H2,1-2H3,(H3,17,18,19,20) |
| InChIKey | QTCBQZQQFUSWOQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |