C15H18ClN3O3 — CID 46901939
2-chloro-6,7-dimethoxy-N-(oxan-4-yl)quinazolin-4-amine (PubChem CID 46901939) has the molecular formula C15H18ClN3O3 and a molecular weight of 323.78 g/mol. Its IUPAC name is 2-chloro-6,7-dimethoxy-N-(oxan-4-yl)quinazolin-4-amine.
| Compound Name | 2-chloro-6,7-dimethoxy-N-(oxan-4-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 46901939 |
| Molecular Formula | C15H18ClN3O3 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 2-chloro-6,7-dimethoxy-N-(oxan-4-yl)quinazolin-4-amine |
| SMILES | COc1cc2nc(Cl)nc(NC3CCOCC3)c2cc1OC |
| InChI | InChI=1S/C15H18ClN3O3/c1-20-12-7-10-11(8-13(12)21-2)18-15(16)19-14(10)17-9-3-5-22-6-4-9/h7-9H,3-6H2,1-2H3,(H,17,18,19) |
| InChIKey | ZBFIHDTUCATFBO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |