About 2-[(2-amino-6,7-dimethoxyquinazolin-4-yl)amino]ethanol
2-[(2-amino-6,7-dimethoxyquinazolin-4-yl)amino]ethanol (PubChem CID 57342964) has the molecular formula C12H16N4O3
and a molecular weight of 264.28 g/mol. Its IUPAC name is 2-[(2-amino-6,7-dimethoxyquinazolin-4-yl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[(2-amino-6,7-dimethoxyquinazolin-4-yl)amino]ethanol |
| PubChem CID | 57342964 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 2-[(2-amino-6,7-dimethoxyquinazolin-4-yl)amino]ethanol |
| SMILES | COc1cc2nc(N)nc(NCCO)c2cc1OC |
| InChI | InChI=1S/C12H16N4O3/c1-18-9-5-7-8(6-10(9)19-2)15-12(13)16-11(7)14-3-4-17/h5-6,17H,3-4H2,1-2H3,(H3,13,14,15,16) |
| InChIKey | LNWOUJGYTOLZOA-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[(2-amino-6,7-dimethoxyquinazolin-4-yl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-amino-6,7-dimethoxyquinazolin-4-yl)amino]ethanol?
The IUPAC name of 2-[(2-amino-6,7-dimethoxyquinazolin-4-yl)amino]ethanol (CID 57342964) is 2-[(2-amino-6,7-dimethoxyquinazolin-4-yl)amino]ethanol.
What is the SMILES notation for 2-[(2-amino-6,7-dimethoxyquinazolin-4-yl)amino]ethanol?
The canonical SMILES for 2-[(2-amino-6,7-dimethoxyquinazolin-4-yl)amino]ethanol is COc1cc2nc(N)nc(NCCO)c2cc1OC.
What is the InChIKey of 2-[(2-amino-6,7-dimethoxyquinazolin-4-yl)amino]ethanol?
The InChIKey is LNWOUJGYTOLZOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O3/c1-18-9-5-7-8(6-10(9)19-2)15-12(13)16-11(7)14-3-4-17/h5-6,17H,3-4H2,1-2H3,(H3,13,14,15,16).
What are the key properties of 2-[(2-amino-6,7-dimethoxyquinazolin-4-yl)amino]ethanol?
2-[(2-amino-6,7-dimethoxyquinazolin-4-yl)amino]ethanol has a molecular weight of 264.28 g/mol, XLogP of 0.63, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-amino-6,7-dimethoxyquinazolin-4-yl)amino]ethanol is sourced from PubChem (CID 57342964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).