C12H16N4O3 — CID 57342964
2-[(2-amino-6,7-dimethoxyquinazolin-4-yl)amino]ethanol (PubChem CID 57342964) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is 2-[(2-amino-6,7-dimethoxyquinazolin-4-yl)amino]ethanol.
| Compound Name | 2-[(2-amino-6,7-dimethoxyquinazolin-4-yl)amino]ethanol |
|---|---|
| PubChem CID | 57342964 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 2-[(2-amino-6,7-dimethoxyquinazolin-4-yl)amino]ethanol |
| SMILES | COc1cc2nc(N)nc(NCCO)c2cc1OC |
| InChI | InChI=1S/C12H16N4O3/c1-18-9-5-7-8(6-10(9)19-2)15-12(13)16-11(7)14-3-4-17/h5-6,17H,3-4H2,1-2H3,(H3,13,14,15,16) |
| InChIKey | LNWOUJGYTOLZOA-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |