C19H21N3O4 — CID 171988113
2-[[2-(3,4,5-trimethoxyphenyl)quinazolin-4-yl]amino]ethanol (PubChem CID 171988113) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is 2-[[2-(3,4,5-trimethoxyphenyl)quinazolin-4-yl]amino]ethanol.
| Compound Name | 2-[[2-(3,4,5-trimethoxyphenyl)quinazolin-4-yl]amino]ethanol |
|---|---|
| PubChem CID | 171988113 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 2-[[2-(3,4,5-trimethoxyphenyl)quinazolin-4-yl]amino]ethanol |
| SMILES | COc1cc(-c2nc(NCCO)c3ccccc3n2)cc(OC)c1OC |
| InChI | InChI=1S/C19H21N3O4/c1-24-15-10-12(11-16(25-2)17(15)26-3)18-21-14-7-5-4-6-13(14)19(22-18)20-8-9-23/h4-7,10-11,23H,8-9H2,1-3H3,(H,20,21,22) |
| InChIKey | AFBJDBRAWYKQEJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 85.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |