C17H15N3O4 — CID 90435743
4-nitroso-2-(3,4,5-trimethoxyphenyl)quinazoline (PubChem CID 90435743) has the molecular formula C17H15N3O4 and a molecular weight of 325.32 g/mol. Its IUPAC name is 4-nitroso-2-(3,4,5-trimethoxyphenyl)quinazoline.
| Compound Name | 4-nitroso-2-(3,4,5-trimethoxyphenyl)quinazoline |
|---|---|
| PubChem CID | 90435743 |
| Molecular Formula | C17H15N3O4 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 4-nitroso-2-(3,4,5-trimethoxyphenyl)quinazoline |
| SMILES | COc1cc(-c2nc(N=O)c3ccccc3n2)cc(OC)c1OC |
| InChI | InChI=1S/C17H15N3O4/c1-22-13-8-10(9-14(23-2)15(13)24-3)16-18-12-7-5-4-6-11(12)17(19-16)20-21/h4-9H,1-3H3 |
| InChIKey | CYYHAQQUGNSJPB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 82.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |