C24H19N5O3 — CID 137290352
3-[[2-(3,4-dimethoxyphenyl)quinazolin-4-yl]diazenyl]-1H-indol-2-ol (PubChem CID 137290352) has the molecular formula C24H19N5O3 and a molecular weight of 425.45 g/mol. Its IUPAC name is 3-[[2-(3,4-dimethoxyphenyl)quinazolin-4-yl]diazenyl]-1H-indol-2-ol.
| Compound Name | 3-[[2-(3,4-dimethoxyphenyl)quinazolin-4-yl]diazenyl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 137290352 |
| Molecular Formula | C24H19N5O3 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 3-[[2-(3,4-dimethoxyphenyl)quinazolin-4-yl]diazenyl]-1H-indol-2-ol |
| SMILES | COc1ccc(-c2nc(/N=N/c3c(O)[nH]c4ccccc34)c3ccccc3n2)cc1OC |
| InChI | InChI=1S/C24H19N5O3/c1-31-19-12-11-14(13-20(19)32-2)22-25-18-10-6-4-8-16(18)23(27-22)29-28-21-15-7-3-5-9-17(15)26-24(21)30/h3-13,26,30H,1-2H3/b29-28+ |
| InChIKey | PAPNATGOBHBQFB-ZQHSETAFSA-N |
| XLogP | 5.92 |
| TPSA | 104.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|