C12H10N6O2 — CID 135455472
3-[(2-hydroxy-1H-indol-3-yl)diazenyl]-6-methyl-4H-1,2,4-triazin-5-one (PubChem CID 135455472) has the molecular formula C12H10N6O2 and a molecular weight of 270.25 g/mol. Its IUPAC name is 3-[(2-hydroxy-1H-indol-3-yl)diazenyl]-6-methyl-4H-1,2,4-triazin-5-one.
| Compound Name | 3-[(2-hydroxy-1H-indol-3-yl)diazenyl]-6-methyl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135455472 |
| Molecular Formula | C12H10N6O2 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 3-[(2-hydroxy-1H-indol-3-yl)diazenyl]-6-methyl-4H-1,2,4-triazin-5-one |
| SMILES | Cc1nnc(/N=N/c2c(O)[nH]c3ccccc23)[nH]c1=O |
| InChI | InChI=1S/C12H10N6O2/c1-6-10(19)14-12(17-15-6)18-16-9-7-4-2-3-5-8(7)13-11(9)20/h2-5,13,20H,1H3,(H,14,17,19)/b18-16+ |
| InChIKey | MUCRZFLTXZPHRS-FBMGVBCBSA-N |
| XLogP | 2.08 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|