C15H13N3O5 — CID 4226240
5-[[(2-hydroxy-1H-indol-3-yl)diazenyl]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 4226240) has the molecular formula C15H13N3O5 and a molecular weight of 315.28 g/mol. Its IUPAC name is 5-[[(2-hydroxy-1H-indol-3-yl)diazenyl]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[[(2-hydroxy-1H-indol-3-yl)diazenyl]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 4226240 |
| Molecular Formula | C15H13N3O5 |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 5-[[(2-hydroxy-1H-indol-3-yl)diazenyl]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=C/N=N/c2c(O)[nH]c3ccccc23)C(=O)O1 |
| InChI | InChI=1S/C15H13N3O5/c1-15(2)22-13(20)9(14(21)23-15)7-16-18-11-8-5-3-4-6-10(8)17-12(11)19/h3-7,17,19H,1-2H3/b18-16+ |
| InChIKey | VJAIWKQSXMNSNR-FBMGVBCBSA-N |
| XLogP | 2.68 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|