C21H20N6O3S — CID 139083842
1,3-bis[(2-hydroxy-1H-indol-3-yl)imino]thiourea;oxolane (PubChem CID 139083842) has the molecular formula C21H20N6O3S and a molecular weight of 436.50 g/mol. Its IUPAC name is 1,3-bis[(2-hydroxy-1H-indol-3-yl)imino]thiourea;oxolane.
| Compound Name | 1,3-bis[(2-hydroxy-1H-indol-3-yl)imino]thiourea;oxolane |
|---|---|
| PubChem CID | 139083842 |
| Molecular Formula | C21H20N6O3S |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 1,3-bis[(2-hydroxy-1H-indol-3-yl)imino]thiourea;oxolane |
| SMILES | C1CCOC1.Oc1[nH]c2ccccc2c1/N=N/C(=S)/N=N/c1c(O)[nH]c2ccccc12 |
| InChI | InChI=1S/C17H12N6O2S.C4H8O/c24-15-13(9-5-1-3-7-11(9)18-15)20-22-17(26)23-21-14-10-6-2-4-8-12(10)19-16(14)25;1-2-4-5-3-1/h1-8,18-19,24-25H;1-4H2/b22-20+,23-21+; |
| InChIKey | ZUVYQFWLBOJTBA-AFLLVNNISA-N |
| XLogP | 6.01 |
| TPSA | 130.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|