C12H13N4O+ — CID 135852417
3-(3,4-dihydro-2H-pyrrol-1-ium-5-yldiazenyl)-1H-indol-2-ol (PubChem CID 135852417) has the molecular formula C12H13N4O+ and a molecular weight of 229.26 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-pyrrol-1-ium-5-yldiazenyl)-1H-indol-2-ol.
| Compound Name | 3-(3,4-dihydro-2H-pyrrol-1-ium-5-yldiazenyl)-1H-indol-2-ol |
|---|---|
| PubChem CID | 135852417 |
| Molecular Formula | C12H13N4O+ |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 3-(3,4-dihydro-2H-pyrrol-1-ium-5-yldiazenyl)-1H-indol-2-ol |
| SMILES | Oc1[nH]c2ccccc2c1/N=N/C1=[NH+]CCC1 |
| InChI | InChI=1S/C12H12N4O/c17-12-11(16-15-10-6-3-7-13-10)8-4-1-2-5-9(8)14-12/h1-2,4-5,14,17H,3,6-7H2/p+1/b16-15+ |
| InChIKey | MGMFULDEWHFDBW-FOCLMDBBSA-O |
| XLogP | 1.23 |
| TPSA | 74.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|