C15H11N3O3 — CID 3784946
2-[(2-hydroxy-1H-indol-3-yl)diazenyl]benzoic acid (PubChem CID 3784946) has the molecular formula C15H11N3O3 and a molecular weight of 281.27 g/mol. Its IUPAC name is 2-[(2-hydroxy-1H-indol-3-yl)diazenyl]benzoic acid.
| Compound Name | 2-[(2-hydroxy-1H-indol-3-yl)diazenyl]benzoic acid |
|---|---|
| PubChem CID | 3784946 |
| Molecular Formula | C15H11N3O3 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-[(2-hydroxy-1H-indol-3-yl)diazenyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1/N=N/c1c(O)[nH]c2ccccc12 |
| InChI | InChI=1S/C15H11N3O3/c19-14-13(9-5-1-3-7-11(9)16-14)18-17-12-8-4-2-6-10(12)15(20)21/h1-8,16,19H,(H,20,21)/b18-17+ |
| InChIKey | FCKHFYRVZUIRLQ-ISLYRVAYSA-N |
| XLogP | 3.99 |
| TPSA | 98.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|