C22H15N3O5 — CID 170853747
2-[4-hydroxy-3-[(2-hydroxy-1H-indol-3-yl)diazenyl]benzoyl]benzoic acid (PubChem CID 170853747) has the molecular formula C22H15N3O5 and a molecular weight of 401.38 g/mol. Its IUPAC name is 2-[4-hydroxy-3-[(2-hydroxy-1H-indol-3-yl)diazenyl]benzoyl]benzoic acid.
| Compound Name | 2-[4-hydroxy-3-[(2-hydroxy-1H-indol-3-yl)diazenyl]benzoyl]benzoic acid |
|---|---|
| PubChem CID | 170853747 |
| Molecular Formula | C22H15N3O5 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 2-[4-hydroxy-3-[(2-hydroxy-1H-indol-3-yl)diazenyl]benzoyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1C(=O)c1ccc(O)c(/N=N/c2c(O)[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C22H15N3O5/c26-18-10-9-12(20(27)13-5-1-2-6-14(13)22(29)30)11-17(18)24-25-19-15-7-3-4-8-16(15)23-21(19)28/h1-11,23,26,28H,(H,29,30)/b25-24+ |
| InChIKey | HXTCRTDOGZQQOA-OCOZRVBESA-N |
| XLogP | 4.92 |
| TPSA | 135.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|