C20H13N5O — CID 168873416
3-[[(Z)-pyrido[3,4-b]indol-3-ylidenemethyl]diazenyl]-1H-indol-2-ol (PubChem CID 168873416) has the molecular formula C20H13N5O and a molecular weight of 339.36 g/mol. Its IUPAC name is 3-[[(Z)-pyrido[3,4-b]indol-3-ylidenemethyl]diazenyl]-1H-indol-2-ol.
| Compound Name | 3-[[(Z)-pyrido[3,4-b]indol-3-ylidenemethyl]diazenyl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 168873416 |
| Molecular Formula | C20H13N5O |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 3-[[(Z)-pyrido[3,4-b]indol-3-ylidenemethyl]diazenyl]-1H-indol-2-ol |
| SMILES | Oc1[nH]c2ccccc2c1/N=N/C=c1/cc2c(cn1)=Nc1ccccc1-2 |
| InChI | InChI=1S/C20H13N5O/c26-20-19(14-6-2-4-8-17(14)24-20)25-22-10-12-9-15-13-5-1-3-7-16(13)23-18(15)11-21-12/h1-11,24,26H/b12-10-,25-22+ |
| InChIKey | YOWDKWMIOVJXTN-DDSRJGQSSA-N |
| XLogP | 3.72 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|