C13H7Cl3N4O — CID 3629318
3-[(3,5,6-trichloro-2-pyridinyl)diazenyl]-1H-indol-2-ol (PubChem CID 3629318) has the molecular formula C13H7Cl3N4O and a molecular weight of 341.59 g/mol. Its IUPAC name is 3-[(3,5,6-trichloro-2-pyridinyl)diazenyl]-1H-indol-2-ol.
| Compound Name | 3-[(3,5,6-trichloro-2-pyridinyl)diazenyl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 3629318 |
| Molecular Formula | C13H7Cl3N4O |
| Molecular Weight | 341.59 g/mol |
| Exact Mass | 339.97 |
| IUPAC Name | 3-[(3,5,6-trichloro-2-pyridinyl)diazenyl]-1H-indol-2-ol |
| SMILES | Oc1[nH]c2ccccc2c1/N=N/c1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H7Cl3N4O/c14-7-5-8(15)12(18-11(7)16)20-19-10-6-3-1-2-4-9(6)17-13(10)21/h1-5,17,21H/b20-19+ |
| InChIKey | POPHRXXMLZABPI-FMQUCBEESA-N |
| XLogP | 5.64 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.59 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|