C16H10ClN5OS2 — CID 135432263
1-(6-chloro-1,3-benzothiazol-2-yl)-3-[(2-hydroxy-1H-indol-3-yl)imino]thiourea (PubChem CID 135432263) has the molecular formula C16H10ClN5OS2 and a molecular weight of 387.88 g/mol. Its IUPAC name is 1-(6-chloro-1,3-benzothiazol-2-yl)-3-[(2-hydroxy-1H-indol-3-yl)imino]thiourea.
| Compound Name | 1-(6-chloro-1,3-benzothiazol-2-yl)-3-[(2-hydroxy-1H-indol-3-yl)imino]thiourea |
|---|---|
| PubChem CID | 135432263 |
| Molecular Formula | C16H10ClN5OS2 |
| Molecular Weight | 387.88 g/mol |
| Exact Mass | 387.00 |
| IUPAC Name | 1-(6-chloro-1,3-benzothiazol-2-yl)-3-[(2-hydroxy-1H-indol-3-yl)imino]thiourea |
| SMILES | Oc1[nH]c2ccccc2c1/N=N/C(=S)Nc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C16H10ClN5OS2/c17-8-5-6-11-12(7-8)25-16(19-11)20-15(24)22-21-13-9-3-1-2-4-10(9)18-14(13)23/h1-7,18,23H,(H,19,20,24)/b22-21+ |
| InChIKey | SZLMCBIKOKACNP-QURGRASLSA-N |
| XLogP | 5.62 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.88 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|