C22H20N4O3 — CID 136666593
3-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-N-[(2-hydroxy-1H-indol-3-yl)imino]-2-oxopropanamide (PubChem CID 136666593) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is 3-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-N-[(2-hydroxy-1H-indol-3-yl)imino]-2-oxopropanamide.
| Compound Name | 3-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-N-[(2-hydroxy-1H-indol-3-yl)imino]-2-oxopropanamide |
|---|---|
| PubChem CID | 136666593 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 3-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-N-[(2-hydroxy-1H-indol-3-yl)imino]-2-oxopropanamide |
| SMILES | CC1(C)Cc2ccccc2C(=CC(=O)C(=O)/N=N/c2c(O)[nH]c3ccccc23)N1 |
| InChI | InChI=1S/C22H20N4O3/c1-22(2)12-13-7-3-4-8-14(13)17(24-22)11-18(27)20(28)26-25-19-15-9-5-6-10-16(15)23-21(19)29/h3-11,23-24,29H,12H2,1-2H3/b17-11?,26-25+ |
| InChIKey | VNEOSEBTUFBTCB-AZUGYIBRSA-N |
| XLogP | 4.02 |
| TPSA | 106.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|