C19H11ClN6O2 — CID 165415908
4-(4-chlorophenyl)-2-[(2-hydroxy-1H-indol-3-yl)diazenyl]-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 165415908) has the molecular formula C19H11ClN6O2 and a molecular weight of 390.79 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-[(2-hydroxy-1H-indol-3-yl)diazenyl]-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-(4-chlorophenyl)-2-[(2-hydroxy-1H-indol-3-yl)diazenyl]-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 165415908 |
| Molecular Formula | C19H11ClN6O2 |
| Molecular Weight | 390.79 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 4-(4-chlorophenyl)-2-[(2-hydroxy-1H-indol-3-yl)diazenyl]-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccc(Cl)cc2)nc(/N=N/c2c(O)[nH]c3ccccc23)[nH]c1=O |
| InChI | InChI=1S/C19H11ClN6O2/c20-11-7-5-10(6-8-11)15-13(9-21)17(27)24-19(23-15)26-25-16-12-3-1-2-4-14(12)22-18(16)28/h1-8,22,28H,(H,23,24,27)/b26-25+ |
| InChIKey | FNWXMNYVBIMRQY-OCEACIFDSA-N |
| XLogP | 4.56 |
| TPSA | 130.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.79 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|