C12H7ClN2O2 — CID 13403846
4-(4-chlorophenyl)-2-hydroxy-6-oxo-1H-pyridine-3-carbonitrile (PubChem CID 13403846) has the molecular formula C12H7ClN2O2 and a molecular weight of 246.65 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-hydroxy-6-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 4-(4-chlorophenyl)-2-hydroxy-6-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 13403846 |
| Molecular Formula | C12H7ClN2O2 |
| Molecular Weight | 246.65 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | 4-(4-chlorophenyl)-2-hydroxy-6-oxo-1H-pyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccc(Cl)cc2)cc(=O)[nH]c1O |
| InChI | InChI=1S/C12H7ClN2O2/c13-8-3-1-7(2-4-8)9-5-11(16)15-12(17)10(9)6-14/h1-5H,(H2,15,16,17) |
| InChIKey | XYMCPJIOPVNRJG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.65 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |