C14H12N4O4 — CID 159463245
2-hydroxy-4-methyl-6-oxo-1H-pyridine-3-carbonitrile (PubChem CID 159463245) has the molecular formula C14H12N4O4 and a molecular weight of 300.27 g/mol. Its IUPAC name is 2-hydroxy-4-methyl-6-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 2-hydroxy-4-methyl-6-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 159463245 |
| Molecular Formula | C14H12N4O4 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2-hydroxy-4-methyl-6-oxo-1H-pyridine-3-carbonitrile |
| SMILES | Cc1cc(=O)[nH]c(O)c1C#N.Cc1cc(=O)[nH]c(O)c1C#N |
| InChI | InChI=1S/2C7H6N2O2/c2*1-4-2-6(10)9-7(11)5(4)3-8/h2*2H,1H3,(H2,9,10,11) |
| InChIKey | LUVVHCQIIDAMOK-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 153.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |