C7H3N3O2 — CID 121227406
2-hydroxy-6-oxo-1H-pyridine-3,4-dicarbonitrile (PubChem CID 121227406) has the molecular formula C7H3N3O2 and a molecular weight of 161.12 g/mol. Its IUPAC name is 2-hydroxy-6-oxo-1H-pyridine-3,4-dicarbonitrile.
| Compound Name | 2-hydroxy-6-oxo-1H-pyridine-3,4-dicarbonitrile |
|---|---|
| PubChem CID | 121227406 |
| Molecular Formula | C7H3N3O2 |
| Molecular Weight | 161.12 g/mol |
| Exact Mass | 161.02 |
| IUPAC Name | 2-hydroxy-6-oxo-1H-pyridine-3,4-dicarbonitrile |
| SMILES | N#Cc1cc(=O)[nH]c(O)c1C#N |
| InChI | InChI=1S/C7H3N3O2/c8-2-4-1-6(11)10-7(12)5(4)3-9/h1H,(H2,10,11,12) |
| InChIKey | UYKJJJJSIXUMQY-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.12 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |