C7H4F2N2O2 — CID 130100027
3-(difluoromethyl)-2-hydroxy-6-oxo-1H-pyridine-4-carbonitrile (PubChem CID 130100027) has the molecular formula C7H4F2N2O2 and a molecular weight of 186.12 g/mol. Its IUPAC name is 3-(difluoromethyl)-2-hydroxy-6-oxo-1H-pyridine-4-carbonitrile.
| Compound Name | 3-(difluoromethyl)-2-hydroxy-6-oxo-1H-pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 130100027 |
| Molecular Formula | C7H4F2N2O2 |
| Molecular Weight | 186.12 g/mol |
| Exact Mass | 186.02 |
| IUPAC Name | 3-(difluoromethyl)-2-hydroxy-6-oxo-1H-pyridine-4-carbonitrile |
| SMILES | N#Cc1cc(=O)[nH]c(O)c1C(F)F |
| InChI | InChI=1S/C7H4F2N2O2/c8-6(9)5-3(2-10)1-4(12)11-7(5)13/h1,6H,(H2,11,12,13) |
| InChIKey | LXWHRUOJFOFBKS-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.12 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |