C10H8F2N2O3 — CID 134685667
methyl 2-[4-cyano-5-(difluoromethyl)-6-oxo-1H-pyridin-2-yl]acetate (PubChem CID 134685667) has the molecular formula C10H8F2N2O3 and a molecular weight of 242.18 g/mol. Its IUPAC name is methyl 2-[4-cyano-5-(difluoromethyl)-6-oxo-1H-pyridin-2-yl]acetate.
| Compound Name | methyl 2-[4-cyano-5-(difluoromethyl)-6-oxo-1H-pyridin-2-yl]acetate |
|---|---|
| PubChem CID | 134685667 |
| Molecular Formula | C10H8F2N2O3 |
| Molecular Weight | 242.18 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | methyl 2-[4-cyano-5-(difluoromethyl)-6-oxo-1H-pyridin-2-yl]acetate |
| SMILES | COC(=O)Cc1cc(C#N)c(C(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C10H8F2N2O3/c1-17-7(15)3-6-2-5(4-13)8(9(11)12)10(16)14-6/h2,9H,3H2,1H3,(H,14,16) |
| InChIKey | RWIRQRKRKGNKMB-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.18 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |