C11H10F2N2O2 — CID 133107710
methyl 2-[4-cyano-3-(difluoromethyl)-6-methyl-2-pyridinyl]acetate (PubChem CID 133107710) has the molecular formula C11H10F2N2O2 and a molecular weight of 240.21 g/mol. Its IUPAC name is methyl 2-[4-cyano-3-(difluoromethyl)-6-methyl-2-pyridinyl]acetate.
| Compound Name | methyl 2-[4-cyano-3-(difluoromethyl)-6-methyl-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 133107710 |
| Molecular Formula | C11H10F2N2O2 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | methyl 2-[4-cyano-3-(difluoromethyl)-6-methyl-2-pyridinyl]acetate |
| SMILES | COC(=O)Cc1nc(C)cc(C#N)c1C(F)F |
| InChI | InChI=1S/C11H10F2N2O2/c1-6-3-7(5-14)10(11(12)13)8(15-6)4-9(16)17-2/h3,11H,4H2,1-2H3 |
| InChIKey | PBRFAWYAOXPVBN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |