C8H7F2NO4 — CID 130100284
methyl 3-(difluoromethyl)-2-hydroxy-6-oxo-1H-pyridine-4-carboxylate (PubChem CID 130100284) has the molecular formula C8H7F2NO4 and a molecular weight of 219.14 g/mol. Its IUPAC name is methyl 3-(difluoromethyl)-2-hydroxy-6-oxo-1H-pyridine-4-carboxylate.
| Compound Name | methyl 3-(difluoromethyl)-2-hydroxy-6-oxo-1H-pyridine-4-carboxylate |
|---|---|
| PubChem CID | 130100284 |
| Molecular Formula | C8H7F2NO4 |
| Molecular Weight | 219.14 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | methyl 3-(difluoromethyl)-2-hydroxy-6-oxo-1H-pyridine-4-carboxylate |
| SMILES | COC(=O)c1cc(=O)[nH]c(O)c1C(F)F |
| InChI | InChI=1S/C8H7F2NO4/c1-15-8(14)3-2-4(12)11-7(13)5(3)6(9)10/h2,6H,1H3,(H2,11,12,13) |
| InChIKey | HQNWGOLZFXGTQY-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.14 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |