C9H9F2NO3 — CID 130083978
methyl 2-(difluoromethyl)-4-methyl-6-oxo-1H-pyridine-3-carboxylate (PubChem CID 130083978) has the molecular formula C9H9F2NO3 and a molecular weight of 217.17 g/mol. Its IUPAC name is methyl 2-(difluoromethyl)-4-methyl-6-oxo-1H-pyridine-3-carboxylate.
| Compound Name | methyl 2-(difluoromethyl)-4-methyl-6-oxo-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 130083978 |
| Molecular Formula | C9H9F2NO3 |
| Molecular Weight | 217.17 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | methyl 2-(difluoromethyl)-4-methyl-6-oxo-1H-pyridine-3-carboxylate |
| SMILES | COC(=O)c1c(C)cc(=O)[nH]c1C(F)F |
| InChI | InChI=1S/C9H9F2NO3/c1-4-3-5(13)12-7(8(10)11)6(4)9(14)15-2/h3,8H,1-2H3,(H,12,13) |
| InChIKey | BZOOVCUMJVNCFO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.17 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |