C9H6F5NO3 — CID 133102257
methyl 2-(difluoromethyl)-4-oxo-5-(trifluoromethyl)-1H-pyridine-3-carboxylate (PubChem CID 133102257) has the molecular formula C9H6F5NO3 and a molecular weight of 271.14 g/mol. Its IUPAC name is methyl 2-(difluoromethyl)-4-oxo-5-(trifluoromethyl)-1H-pyridine-3-carboxylate.
| Compound Name | methyl 2-(difluoromethyl)-4-oxo-5-(trifluoromethyl)-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 133102257 |
| Molecular Formula | C9H6F5NO3 |
| Molecular Weight | 271.14 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | methyl 2-(difluoromethyl)-4-oxo-5-(trifluoromethyl)-1H-pyridine-3-carboxylate |
| SMILES | COC(=O)c1c(C(F)F)[nH]cc(C(F)(F)F)c1=O |
| InChI | InChI=1S/C9H6F5NO3/c1-18-8(17)4-5(7(10)11)15-2-3(6(4)16)9(12,13)14/h2,7H,1H3,(H,15,16) |
| InChIKey | HZMDFGCBHAFARZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.14 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |