C10H6F6O3 — CID 134639096
methyl 4-hydroxy-2,6-bis(trifluoromethyl)benzoate (PubChem CID 134639096) has the molecular formula C10H6F6O3 and a molecular weight of 288.14 g/mol. Its IUPAC name is methyl 4-hydroxy-2,6-bis(trifluoromethyl)benzoate.
| Compound Name | methyl 4-hydroxy-2,6-bis(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 134639096 |
| Molecular Formula | C10H6F6O3 |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | methyl 4-hydroxy-2,6-bis(trifluoromethyl)benzoate |
| SMILES | COC(=O)c1c(C(F)(F)F)cc(O)cc1C(F)(F)F |
| InChI | InChI=1S/C10H6F6O3/c1-19-8(18)7-5(9(11,12)13)2-4(17)3-6(7)10(14,15)16/h2-3,17H,1H3 |
| InChIKey | CEEFDNWLCVIUJH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |