C14H13F6O3P — CID 90431498
methyl 4-(1-oxo-1λ5-phospholan-1-yl)-2,6-bis(trifluoromethyl)benzoate (PubChem CID 90431498) has the molecular formula C14H13F6O3P and a molecular weight of 374.22 g/mol. Its IUPAC name is methyl 4-(1-oxo-1λ5-phospholan-1-yl)-2,6-bis(trifluoromethyl)benzoate.
| Compound Name | methyl 4-(1-oxo-1λ5-phospholan-1-yl)-2,6-bis(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 90431498 |
| Molecular Formula | C14H13F6O3P |
| Molecular Weight | 374.22 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | methyl 4-(1-oxo-1λ5-phospholan-1-yl)-2,6-bis(trifluoromethyl)benzoate |
| SMILES | COC(=O)c1c(C(F)(F)F)cc(P2(=O)CCCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C14H13F6O3P/c1-23-12(21)11-9(13(15,16)17)6-8(7-10(11)14(18,19)20)24(22)4-2-3-5-24/h6-7H,2-5H2,1H3 |
| InChIKey | BOKYGQSKEBAAFQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.22 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|