C9H9F2NO4 — CID 133103363
methyl 6-(difluoromethyl)-3-methoxy-2-oxo-1H-pyridine-4-carboxylate (PubChem CID 133103363) has the molecular formula C9H9F2NO4 and a molecular weight of 233.17 g/mol. Its IUPAC name is methyl 6-(difluoromethyl)-3-methoxy-2-oxo-1H-pyridine-4-carboxylate.
| Compound Name | methyl 6-(difluoromethyl)-3-methoxy-2-oxo-1H-pyridine-4-carboxylate |
|---|---|
| PubChem CID | 133103363 |
| Molecular Formula | C9H9F2NO4 |
| Molecular Weight | 233.17 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | methyl 6-(difluoromethyl)-3-methoxy-2-oxo-1H-pyridine-4-carboxylate |
| SMILES | COC(=O)c1cc(C(F)F)[nH]c(=O)c1OC |
| InChI | InChI=1S/C9H9F2NO4/c1-15-6-4(9(14)16-2)3-5(7(10)11)12-8(6)13/h3,7H,1-2H3,(H,12,13) |
| InChIKey | XCJVKJSNHWKWSD-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.17 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |