C9H9BrF2N2O2 — CID 134685150
methyl 2-(aminomethyl)-6-bromo-3-(difluoromethyl)pyridine-4-carboxylate (PubChem CID 134685150) has the molecular formula C9H9BrF2N2O2 and a molecular weight of 295.08 g/mol. Its IUPAC name is methyl 2-(aminomethyl)-6-bromo-3-(difluoromethyl)pyridine-4-carboxylate.
| Compound Name | methyl 2-(aminomethyl)-6-bromo-3-(difluoromethyl)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 134685150 |
| Molecular Formula | C9H9BrF2N2O2 |
| Molecular Weight | 295.08 g/mol |
| Exact Mass | 293.98 |
| IUPAC Name | methyl 2-(aminomethyl)-6-bromo-3-(difluoromethyl)pyridine-4-carboxylate |
| SMILES | COC(=O)c1cc(Br)nc(CN)c1C(F)F |
| InChI | InChI=1S/C9H9BrF2N2O2/c1-16-9(15)4-2-6(10)14-5(3-13)7(4)8(11)12/h2,8H,3,13H2,1H3 |
| InChIKey | ZYMJAZKDGXNIBW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.08 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|