C10H12F2N2O2 — CID 133098700
methyl 2-(aminomethyl)-5-(difluoromethyl)-6-methylpyridine-3-carboxylate (PubChem CID 133098700) has the molecular formula C10H12F2N2O2 and a molecular weight of 230.21 g/mol. Its IUPAC name is methyl 2-(aminomethyl)-5-(difluoromethyl)-6-methylpyridine-3-carboxylate.
| Compound Name | methyl 2-(aminomethyl)-5-(difluoromethyl)-6-methylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 133098700 |
| Molecular Formula | C10H12F2N2O2 |
| Molecular Weight | 230.21 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | methyl 2-(aminomethyl)-5-(difluoromethyl)-6-methylpyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(C(F)F)c(C)nc1CN |
| InChI | InChI=1S/C10H12F2N2O2/c1-5-6(9(11)12)3-7(10(15)16-2)8(4-13)14-5/h3,9H,4,13H2,1-2H3 |
| InChIKey | IDRWQFNLUWSMEV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.21 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |