C10H10ClF2NO2 — CID 130090555
methyl 2-(chloromethyl)-5-(difluoromethyl)-6-methylpyridine-3-carboxylate (PubChem CID 130090555) has the molecular formula C10H10ClF2NO2 and a molecular weight of 249.64 g/mol. Its IUPAC name is methyl 2-(chloromethyl)-5-(difluoromethyl)-6-methylpyridine-3-carboxylate.
| Compound Name | methyl 2-(chloromethyl)-5-(difluoromethyl)-6-methylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 130090555 |
| Molecular Formula | C10H10ClF2NO2 |
| Molecular Weight | 249.64 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | methyl 2-(chloromethyl)-5-(difluoromethyl)-6-methylpyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(C(F)F)c(C)nc1CCl |
| InChI | InChI=1S/C10H10ClF2NO2/c1-5-6(9(12)13)3-7(10(15)16-2)8(4-11)14-5/h3,9H,4H2,1-2H3 |
| InChIKey | OJILUBZIIYBYDV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.64 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|