C7H5N2OS- — CID 3667173
3-cyano-4-methyl-6-oxo-1H-pyridine-2-thiolate (PubChem CID 3667173) has the molecular formula C7H5N2OS- and a molecular weight of 165.20 g/mol. Its IUPAC name is 3-cyano-4-methyl-6-oxo-1H-pyridine-2-thiolate.
| Compound Name | 3-cyano-4-methyl-6-oxo-1H-pyridine-2-thiolate |
|---|---|
| PubChem CID | 3667173 |
| Molecular Formula | C7H5N2OS- |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.01 |
| IUPAC Name | 3-cyano-4-methyl-6-oxo-1H-pyridine-2-thiolate |
| SMILES | Cc1cc(=O)[nH]c([S-])c1C#N |
| InChI | InChI=1S/C7H6N2OS/c1-4-2-6(10)9-7(11)5(4)3-8/h2H,1H3,(H2,9,10,11)/p-1 |
| InChIKey | QNEWVOYCROIYKG-UHFFFAOYSA-M |
| XLogP | 0.46 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|