C8H8N2S — CID 676510
4,6-dimethyl-2-sulfanylidene-1H-pyridine-3-carbonitrile (PubChem CID 676510) has the molecular formula C8H8N2S and a molecular weight of 164.23 g/mol. Its IUPAC name is 4,6-dimethyl-2-sulfanylidene-1H-pyridine-3-carbonitrile.
| Compound Name | 4,6-dimethyl-2-sulfanylidene-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 676510 |
| Molecular Formula | C8H8N2S |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.04 |
| IUPAC Name | 4,6-dimethyl-2-sulfanylidene-1H-pyridine-3-carbonitrile |
| SMILES | Cc1cc(C)c(C#N)c(=S)[nH]1 |
| InChI | InChI=1S/C8H8N2S/c1-5-3-6(2)10-8(11)7(5)4-9/h3H,1-2H3,(H,10,11) |
| InChIKey | CZRHEROEPICLRO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 39.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_A(54)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|