C12H12N8S2 — CID 139087413
4,6-diamino-2-sulfanylidene-1H-pyridine-3-carbonitrile (PubChem CID 139087413) has the molecular formula C12H12N8S2 and a molecular weight of 332.42 g/mol. Its IUPAC name is 4,6-diamino-2-sulfanylidene-1H-pyridine-3-carbonitrile.
| Compound Name | 4,6-diamino-2-sulfanylidene-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 139087413 |
| Molecular Formula | C12H12N8S2 |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 4,6-diamino-2-sulfanylidene-1H-pyridine-3-carbonitrile |
| SMILES | N#Cc1c(N)cc(N)[nH]c1=S.N#Cc1c(N)cc(N)[nH]c1=S |
| InChI | InChI=1S/2C6H6N4S/c2*7-2-3-4(8)1-5(9)10-6(3)11/h2*1H,(H5,8,9,10,11) |
| InChIKey | SFFQUYYFPFVMJS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 183.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_A(54)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|