C18H13N5S — CID 15396827
1,8-diamino-5-methyl-6-phenyl-3-sulfanylidene-2H-isoquinoline-4,7-dicarbonitrile (PubChem CID 15396827) has the molecular formula C18H13N5S and a molecular weight of 331.40 g/mol. Its IUPAC name is 1,8-diamino-5-methyl-6-phenyl-3-sulfanylidene-2H-isoquinoline-4,7-dicarbonitrile.
| Compound Name | 1,8-diamino-5-methyl-6-phenyl-3-sulfanylidene-2H-isoquinoline-4,7-dicarbonitrile |
|---|---|
| PubChem CID | 15396827 |
| Molecular Formula | C18H13N5S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 1,8-diamino-5-methyl-6-phenyl-3-sulfanylidene-2H-isoquinoline-4,7-dicarbonitrile |
| SMILES | Cc1c(-c2ccccc2)c(C#N)c(N)c2c(N)[nH]c(=S)c(C#N)c12 |
| InChI | InChI=1S/C18H13N5S/c1-9-13(10-5-3-2-4-6-10)11(7-19)16(21)15-14(9)12(8-20)18(24)23-17(15)22/h2-6H,21H2,1H3,(H3,22,23,24) |
| InChIKey | DKABTTUTFPMQJJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 115.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_A(54)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|