C17H13N3 — CID 102016835
2-amino-4,5-diphenyl-1H-pyrrole-3-carbonitrile (PubChem CID 102016835) has the molecular formula C17H13N3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-amino-4,5-diphenyl-1H-pyrrole-3-carbonitrile.
| Compound Name | 2-amino-4,5-diphenyl-1H-pyrrole-3-carbonitrile |
|---|---|
| PubChem CID | 102016835 |
| Molecular Formula | C17H13N3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 2-amino-4,5-diphenyl-1H-pyrrole-3-carbonitrile |
| SMILES | N#Cc1c(N)[nH]c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C17H13N3/c18-11-14-15(12-7-3-1-4-8-12)16(20-17(14)19)13-9-5-2-6-10-13/h1-10,20H,19H2 |
| InChIKey | VKHVVUFBKPSVBQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 65.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |