C16H10N4 — CID 91739124
2-amino-3-phenyl-1H-indole-5,6-dicarbonitrile (PubChem CID 91739124) has the molecular formula C16H10N4 and a molecular weight of 258.28 g/mol. Its IUPAC name is 2-amino-3-phenyl-1H-indole-5,6-dicarbonitrile.
| Compound Name | 2-amino-3-phenyl-1H-indole-5,6-dicarbonitrile |
|---|---|
| PubChem CID | 91739124 |
| Molecular Formula | C16H10N4 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 2-amino-3-phenyl-1H-indole-5,6-dicarbonitrile |
| SMILES | N#Cc1cc2[nH]c(N)c(-c3ccccc3)c2cc1C#N |
| InChI | InChI=1S/C16H10N4/c17-8-11-6-13-14(7-12(11)9-18)20-16(19)15(13)10-4-2-1-3-5-10/h1-7,20H,19H2 |
| InChIKey | NDFXGNYZYWQPRK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |