C22H18N2 — CID 172835095
3,4,5-triphenyl-1H-pyrrol-2-amine (PubChem CID 172835095) has the molecular formula C22H18N2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 3,4,5-triphenyl-1H-pyrrol-2-amine.
| Compound Name | 3,4,5-triphenyl-1H-pyrrol-2-amine |
|---|---|
| PubChem CID | 172835095 |
| Molecular Formula | C22H18N2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 3,4,5-triphenyl-1H-pyrrol-2-amine |
| SMILES | Nc1[nH]c(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C22H18N2/c23-22-20(17-12-6-2-7-13-17)19(16-10-4-1-5-11-16)21(24-22)18-14-8-3-9-15-18/h1-15,24H,23H2 |
| InChIKey | WASZLQTZARTLLH-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |