C22H16ClN — CID 174984725
2-chloro-3,4,5-triphenyl-1H-pyrrole (PubChem CID 174984725) has the molecular formula C22H16ClN and a molecular weight of 329.83 g/mol. Its IUPAC name is 2-chloro-3,4,5-triphenyl-1H-pyrrole.
| Compound Name | 2-chloro-3,4,5-triphenyl-1H-pyrrole |
|---|---|
| PubChem CID | 174984725 |
| Molecular Formula | C22H16ClN |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 2-chloro-3,4,5-triphenyl-1H-pyrrole |
| SMILES | Clc1[nH]c(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C22H16ClN/c23-22-20(17-12-6-2-7-13-17)19(16-10-4-1-5-11-16)21(24-22)18-14-8-3-9-15-18/h1-15,24H |
| InChIKey | FMHRYSMPDYUHHZ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |