C16H10Cl2O — CID 139844341
2,5-dichloro-3,4-diphenylfuran (PubChem CID 139844341) has the molecular formula C16H10Cl2O and a molecular weight of 289.16 g/mol. Its IUPAC name is 2,5-dichloro-3,4-diphenylfuran.
| Compound Name | 2,5-dichloro-3,4-diphenylfuran |
|---|---|
| PubChem CID | 139844341 |
| Molecular Formula | C16H10Cl2O |
| Molecular Weight | 289.16 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 2,5-dichloro-3,4-diphenylfuran |
| SMILES | Clc1oc(Cl)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C16H10Cl2O/c17-15-13(11-7-3-1-4-8-11)14(16(18)19-15)12-9-5-2-6-10-12/h1-10H |
| InChIKey | MNSRVEMZGSMKBF-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.16 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |