C9H7ClN2O — CID 69335141
4-chloro-2-phenyl-1,3-oxazol-5-amine (PubChem CID 69335141) has the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. Its IUPAC name is 4-chloro-2-phenyl-1,3-oxazol-5-amine.
| Compound Name | 4-chloro-2-phenyl-1,3-oxazol-5-amine |
|---|---|
| PubChem CID | 69335141 |
| Molecular Formula | C9H7ClN2O |
| Molecular Weight | 194.62 g/mol |
| Exact Mass | 194.02 |
| IUPAC Name | 4-chloro-2-phenyl-1,3-oxazol-5-amine |
| SMILES | Nc1oc(-c2ccccc2)nc1Cl |
| InChI | InChI=1S/C9H7ClN2O/c10-7-8(11)13-9(12-7)6-4-2-1-3-5-6/h1-5H,11H2 |
| InChIKey | TWVVOQCODRZFOF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.62 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |