C10H9N3OS — CID 2741465
5-amino-2-phenyl-1,3-oxazole-4-carbothioamide (PubChem CID 2741465) has the molecular formula C10H9N3OS and a molecular weight of 219.27 g/mol. Its IUPAC name is 5-amino-2-phenyl-1,3-oxazole-4-carbothioamide.
| Compound Name | 5-amino-2-phenyl-1,3-oxazole-4-carbothioamide |
|---|---|
| PubChem CID | 2741465 |
| Molecular Formula | C10H9N3OS |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 5-amino-2-phenyl-1,3-oxazole-4-carbothioamide |
| SMILES | NC(=S)c1nc(-c2ccccc2)oc1N |
| InChI | InChI=1S/C10H9N3OS/c11-8-7(9(12)15)13-10(14-8)6-4-2-1-3-5-6/h1-5H,11H2,(H2,12,15) |
| InChIKey | BQZMBDROZJKJJV-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|