C17H13N3O3 — CID 90949372
5-benzamido-2-phenyl-1,3-oxazole-4-carboxamide (PubChem CID 90949372) has the molecular formula C17H13N3O3 and a molecular weight of 307.31 g/mol. Its IUPAC name is 5-benzamido-2-phenyl-1,3-oxazole-4-carboxamide.
| Compound Name | 5-benzamido-2-phenyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 90949372 |
| Molecular Formula | C17H13N3O3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 5-benzamido-2-phenyl-1,3-oxazole-4-carboxamide |
| SMILES | NC(=O)c1nc(-c2ccccc2)oc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H13N3O3/c18-14(21)13-17(20-15(22)11-7-3-1-4-8-11)23-16(19-13)12-9-5-2-6-10-12/h1-10H,(H2,18,21)(H,20,22) |
| InChIKey | NILHDSXCDSILLY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |