C20H14N4O2 — CID 67153787
N-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)-2-pyridinyl]benzamide (PubChem CID 67153787) has the molecular formula C20H14N4O2 and a molecular weight of 342.36 g/mol. Its IUPAC name is N-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)-2-pyridinyl]benzamide.
| Compound Name | N-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 67153787 |
| Molecular Formula | C20H14N4O2 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | N-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)-2-pyridinyl]benzamide |
| SMILES | O=C(Nc1cc(-c2nnc(-c3ccccc3)o2)ccn1)c1ccccc1 |
| InChI | InChI=1S/C20H14N4O2/c25-18(14-7-3-1-4-8-14)22-17-13-16(11-12-21-17)20-24-23-19(26-20)15-9-5-2-6-10-15/h1-13H,(H,21,22,25) |
| InChIKey | IJGVKWFATVJNIF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |