About [4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]carbamic acid
[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]carbamic acid (PubChem CID 166061915) has the molecular formula C9H6F2N4O3
and a molecular weight of 256.17 g/mol. Its IUPAC name is [4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]carbamic acid.
Molecular Properties
| Compound Name | [4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]carbamic acid |
| PubChem CID | 166061915 |
| Molecular Formula | C9H6F2N4O3 |
| Molecular Weight | 256.17 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | [4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]carbamic acid |
| SMILES | O=C(O)Nc1cc(-c2nnc(C(F)F)o2)ccn1 |
| InChI | InChI=1S/C9H6F2N4O3/c10-6(11)8-15-14-7(18-8)4-1-2-12-5(3-4)13-9(16)17/h1-3,6H,(H,12,13)(H,16,17) |
| InChIKey | CBNDUGYAIYIANK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 101.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.17 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]carbamic acid?
The IUPAC name of [4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]carbamic acid (CID 166061915) is [4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]carbamic acid.
What is the SMILES notation for [4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]carbamic acid?
The canonical SMILES for [4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]carbamic acid is O=C(O)Nc1cc(-c2nnc(C(F)F)o2)ccn1.
What is the InChIKey of [4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]carbamic acid?
The InChIKey is CBNDUGYAIYIANK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F2N4O3/c10-6(11)8-15-14-7(18-8)4-1-2-12-5(3-4)13-9(16)17/h1-3,6H,(H,12,13)(H,16,17).
What are the key properties of [4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]carbamic acid?
[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]carbamic acid has a molecular weight of 256.17 g/mol, XLogP of 2.16, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]carbamic acid is sourced from PubChem (CID 166061915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).