C12H12N4O2 — CID 25103539
N-(diaminomethylidene)-5-methyl-2-phenyl-1,3-oxazole-4-carboxamide (PubChem CID 25103539) has the molecular formula C12H12N4O2 and a molecular weight of 244.25 g/mol. Its IUPAC name is N-(diaminomethylidene)-5-methyl-2-phenyl-1,3-oxazole-4-carboxamide.
| Compound Name | N-(diaminomethylidene)-5-methyl-2-phenyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 25103539 |
| Molecular Formula | C12H12N4O2 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | N-(diaminomethylidene)-5-methyl-2-phenyl-1,3-oxazole-4-carboxamide |
| SMILES | Cc1oc(-c2ccccc2)nc1C(=O)N=C(N)N |
| InChI | InChI=1S/C12H12N4O2/c1-7-9(10(17)16-12(13)14)15-11(18-7)8-5-3-2-4-6-8/h2-6H,1H3,(H4,13,14,16,17) |
| InChIKey | ORKJMJIXZFSGHR-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 107.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|