C20H19NO3 — CID 30724380
(2,4,6-trimethylphenyl) 5-methyl-2-phenyl-1,3-oxazole-4-carboxylate (PubChem CID 30724380) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is (2,4,6-trimethylphenyl) 5-methyl-2-phenyl-1,3-oxazole-4-carboxylate.
| Compound Name | (2,4,6-trimethylphenyl) 5-methyl-2-phenyl-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 30724380 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | (2,4,6-trimethylphenyl) 5-methyl-2-phenyl-1,3-oxazole-4-carboxylate |
| SMILES | Cc1cc(C)c(OC(=O)c2nc(-c3ccccc3)oc2C)c(C)c1 |
| InChI | InChI=1S/C20H19NO3/c1-12-10-13(2)18(14(3)11-12)24-20(22)17-15(4)23-19(21-17)16-8-6-5-7-9-16/h5-11H,1-4H3 |
| InChIKey | NIGSHCQMPLMHGE-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|